C31H24N4OS — CID 135717815
4-[C-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one (PubChem CID 135717815) has the molecular formula C31H24N4OS and a molecular weight of 500.63 g/mol. Its IUPAC name is 4-[C-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one.
| Compound Name | 4-[C-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 135717815 |
| Molecular Formula | C31H24N4OS |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | 4-[C-methyl-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]carbonimidoyl]-2,5-diphenyl-1H-pyrazol-3-one |
| SMILES | C/C(=N\c1ccc(-c2nc3ccc(C)cc3s2)cc1)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C31H24N4OS/c1-20-13-18-26-27(19-20)37-30(33-26)23-14-16-24(17-15-23)32-21(2)28-29(22-9-5-3-6-10-22)34-35(31(28)36)25-11-7-4-8-12-25/h3-19,34H,1-2H3/b32-21+ |
| InChIKey | UWOBRAIDNVYBPV-RUMWWMSVSA-N |
| XLogP | 7.56 |
| TPSA | 63.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|