C24H19N4O3- — CID 136882805
2-[[(Z)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]carbamoyl]phenolate (PubChem CID 136882805) has the molecular formula C24H19N4O3- and a molecular weight of 411.44 g/mol. Its IUPAC name is 2-[[(Z)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]carbamoyl]phenolate.
| Compound Name | 2-[[(Z)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]carbamoyl]phenolate |
|---|---|
| PubChem CID | 136882805 |
| Molecular Formula | C24H19N4O3- |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-[[(Z)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]carbamoyl]phenolate |
| SMILES | C/C(=N/NC(=O)c1ccccc1[O-])c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H20N4O3/c1-16(25-26-23(30)19-14-8-9-15-20(19)29)21-22(17-10-4-2-5-11-17)27-28(24(21)31)18-12-6-3-7-13-18/h2-15,27,29H,1H3,(H,26,30)/p-1/b25-16- |
| InChIKey | BPWPEQFUHHRORP-XYGWBWBKSA-M |
| XLogP | 3.06 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|