C24H20ClN5OS — CID 136825701
1-[(Z)-[(2-chlorophenyl)-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylidene]amino]-3-methylthiourea (PubChem CID 136825701) has the molecular formula C24H20ClN5OS and a molecular weight of 461.98 g/mol. Its IUPAC name is 1-[(Z)-[(2-chlorophenyl)-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylidene]amino]-3-methylthiourea.
| Compound Name | 1-[(Z)-[(2-chlorophenyl)-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylidene]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 136825701 |
| Molecular Formula | C24H20ClN5OS |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 1-[(Z)-[(2-chlorophenyl)-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)methylidene]amino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C(\c1ccccc1Cl)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H20ClN5OS/c1-26-24(32)28-27-22(18-14-8-9-15-19(18)25)20-21(16-10-4-2-5-11-16)29-30(23(20)31)17-12-6-3-7-13-17/h2-15,29H,1H3,(H2,26,28,32)/b27-22+ |
| InChIKey | JFMVDZVOYAIGQD-HPNDGRJYSA-N |
| XLogP | 4.33 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|