C22H16N2O2 — CID 12053553
4-benzoyl-2,5-diphenyl-1H-pyrazol-3-one (PubChem CID 12053553) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-benzoyl-2,5-diphenyl-1H-pyrazol-3-one.
| Compound Name | 4-benzoyl-2,5-diphenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 12053553 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4-benzoyl-2,5-diphenyl-1H-pyrazol-3-one |
| SMILES | O=C(c1ccccc1)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H16N2O2/c25-21(17-12-6-2-7-13-17)19-20(16-10-4-1-5-11-16)23-24(22(19)26)18-14-8-3-9-15-18/h1-15,23H |
| InChIKey | XXGVPCIBOCETLF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |