C24H19BrN4O2 — CID 135687862
2-bromo-N-[(E)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]benzamide (PubChem CID 135687862) has the molecular formula C24H19BrN4O2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 2-bromo-N-[(E)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]benzamide.
| Compound Name | 2-bromo-N-[(E)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 135687862 |
| Molecular Formula | C24H19BrN4O2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 2-bromo-N-[(E)-1-(3-oxo-2,5-diphenyl-1H-pyrazol-4-yl)ethylideneamino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1Br)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C24H19BrN4O2/c1-16(26-27-23(30)19-14-8-9-15-20(19)25)21-22(17-10-4-2-5-11-17)28-29(24(21)31)18-12-6-3-7-13-18/h2-15,28H,1H3,(H,27,30)/b26-16+ |
| InChIKey | VVKXDFMDRGPASL-WGOQTCKBSA-N |
| XLogP | 4.75 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|