C33H44N2O2 — CID 70409795
4-[(Z)-octadec-9-enoyl]-2,5-diphenyl-1H-pyrazol-3-one (PubChem CID 70409795) has the molecular formula C33H44N2O2 and a molecular weight of 500.73 g/mol. Its IUPAC name is 4-[(Z)-octadec-9-enoyl]-2,5-diphenyl-1H-pyrazol-3-one.
| Compound Name | 4-[(Z)-octadec-9-enoyl]-2,5-diphenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 70409795 |
| Molecular Formula | C33H44N2O2 |
| Molecular Weight | 500.73 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | 4-[(Z)-octadec-9-enoyl]-2,5-diphenyl-1H-pyrazol-3-one |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)c1c(-c2ccccc2)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C33H44N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22-27-30(36)31-32(28-23-18-16-19-24-28)34-35(33(31)37)29-25-20-17-21-26-29/h9-10,16-21,23-26,34H,2-8,11-15,22,27H2,1H3/b10-9- |
| InChIKey | KKCUFTLLEFUAGF-KTKRTIGZSA-N |
| XLogP | 9.05 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.73 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|