C22H21N7O5S — CID 135426892
N-(5,6-dimethoxypyrimidin-4-yl)-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]benzenesulfonamide (PubChem CID 135426892) has the molecular formula C22H21N7O5S and a molecular weight of 495.52 g/mol. Its IUPAC name is N-(5,6-dimethoxypyrimidin-4-yl)-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]benzenesulfonamide.
| Compound Name | N-(5,6-dimethoxypyrimidin-4-yl)-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135426892 |
| Molecular Formula | C22H21N7O5S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-(5,6-dimethoxypyrimidin-4-yl)-4-[(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)diazenyl]benzenesulfonamide |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(/N=N/c3c(C)[nH]n(-c4ccccc4)c3=O)cc2)c1OC |
| InChI | InChI=1S/C22H21N7O5S/c1-14-18(22(30)29(27-14)16-7-5-4-6-8-16)26-25-15-9-11-17(12-10-15)35(31,32)28-20-19(33-2)21(34-3)24-13-23-20/h4-13,27H,1-3H3,(H,23,24,28)/b26-25+ |
| InChIKey | GHUHWVINAFAZOD-OCEACIFDSA-N |
| XLogP | 3.50 |
| TPSA | 152.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|