C17H23N5O6S2 — CID 133083516
N-[4-[(5,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]piperidine-1-sulfonamide (PubChem CID 133083516) has the molecular formula C17H23N5O6S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[4-[(5,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]piperidine-1-sulfonamide.
| Compound Name | N-[4-[(5,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 133083516 |
| Molecular Formula | C17H23N5O6S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | N-[4-[(5,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]piperidine-1-sulfonamide |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(NS(=O)(=O)N3CCCCC3)cc2)c1OC |
| InChI | InChI=1S/C17H23N5O6S2/c1-27-15-16(18-12-19-17(15)28-2)21-29(23,24)14-8-6-13(7-9-14)20-30(25,26)22-10-4-3-5-11-22/h6-9,12,20H,3-5,10-11H2,1-2H3,(H,18,19,21) |
| InChIKey | PTDUVEDUYQHEFE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |