C17H15N3O6S — CID 169336208
N-(5,6-dimethoxypyrimidin-4-yl)-4-(5-formylfuran-2-yl)benzenesulfonamide (PubChem CID 169336208) has the molecular formula C17H15N3O6S and a molecular weight of 389.39 g/mol. Its IUPAC name is N-(5,6-dimethoxypyrimidin-4-yl)-4-(5-formylfuran-2-yl)benzenesulfonamide.
| Compound Name | N-(5,6-dimethoxypyrimidin-4-yl)-4-(5-formylfuran-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 169336208 |
| Molecular Formula | C17H15N3O6S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | N-(5,6-dimethoxypyrimidin-4-yl)-4-(5-formylfuran-2-yl)benzenesulfonamide |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(-c3ccc(C=O)o3)cc2)c1OC |
| InChI | InChI=1S/C17H15N3O6S/c1-24-15-16(18-10-19-17(15)25-2)20-27(22,23)13-6-3-11(4-7-13)14-8-5-12(9-21)26-14/h3-10H,1-2H3,(H,18,19,20) |
| InChIKey | DXPJCMJEANBUEF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|