C26H20ClN3O5S — CID 87510001
5-[4-[4-(benzenesulfonyl)anilino]-7-methoxyquinazolin-6-yl]furan-2-carbaldehyde;hydrochloride (PubChem CID 87510001) has the molecular formula C26H20ClN3O5S and a molecular weight of 521.98 g/mol. Its IUPAC name is 5-[4-[4-(benzenesulfonyl)anilino]-7-methoxyquinazolin-6-yl]furan-2-carbaldehyde;hydrochloride.
| Compound Name | 5-[4-[4-(benzenesulfonyl)anilino]-7-methoxyquinazolin-6-yl]furan-2-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 87510001 |
| Molecular Formula | C26H20ClN3O5S |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 5-[4-[4-(benzenesulfonyl)anilino]-7-methoxyquinazolin-6-yl]furan-2-carbaldehyde;hydrochloride |
| SMILES | COc1cc2ncnc(Nc3ccc(S(=O)(=O)c4ccccc4)cc3)c2cc1-c1ccc(C=O)o1.Cl |
| InChI | InChI=1S/C26H19N3O5S.ClH/c1-33-25-14-23-21(13-22(25)24-12-9-18(15-30)34-24)26(28-16-27-23)29-17-7-10-20(11-8-17)35(31,32)19-5-3-2-4-6-19;/h2-16H,1H3,(H,27,28,29);1H |
| InChIKey | AESRACCRNMQPNN-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|