C26H16ClF2N3O3 — CID 22018105
5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-fluoroquinazolin-6-yl]furan-2-carbaldehyde (PubChem CID 22018105) has the molecular formula C26H16ClF2N3O3 and a molecular weight of 491.88 g/mol. Its IUPAC name is 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-fluoroquinazolin-6-yl]furan-2-carbaldehyde.
| Compound Name | 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-fluoroquinazolin-6-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 22018105 |
| Molecular Formula | C26H16ClF2N3O3 |
| Molecular Weight | 491.88 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-fluoroquinazolin-6-yl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc3c(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)ncnc3cc2F)o1 |
| InChI | InChI=1S/C26H16ClF2N3O3/c27-21-9-17(4-6-25(21)34-13-15-2-1-3-16(28)8-15)32-26-20-10-19(24-7-5-18(12-33)35-24)22(29)11-23(20)30-14-31-26/h1-12,14H,13H2,(H,30,31,32) |
| InChIKey | KYQPDPFVNRETJX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.88 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|