C25H16F2N4O3 — CID 87717624
5-[4-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde (PubChem CID 87717624) has the molecular formula C25H16F2N4O3 and a molecular weight of 458.42 g/mol. Its IUPAC name is 5-[4-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde.
| Compound Name | 5-[4-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 87717624 |
| Molecular Formula | C25H16F2N4O3 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 5-[4-[3-fluoro-4-[(3-fluorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc3c(Nc4ccc(OCc5cccc(F)c5)c(F)c4)ncnc3cn2)o1 |
| InChI | InChI=1S/C25H16F2N4O3/c26-16-3-1-2-15(8-16)13-33-23-6-4-17(9-20(23)27)31-25-19-10-21(24-7-5-18(12-32)34-24)28-11-22(19)29-14-30-25/h1-12,14H,13H2,(H,29,30,31) |
| InChIKey | LEUMAKZVMOSZEJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|