C30H26ClFN4O2 — CID 90196894
6-[5-[[[(E)-but-2-enyl]amino]methyl]furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine (PubChem CID 90196894) has the molecular formula C30H26ClFN4O2 and a molecular weight of 529.02 g/mol. Its IUPAC name is 6-[5-[[[(E)-but-2-enyl]amino]methyl]furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine.
| Compound Name | 6-[5-[[[(E)-but-2-enyl]amino]methyl]furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 90196894 |
| Molecular Formula | C30H26ClFN4O2 |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 6-[5-[[[(E)-but-2-enyl]amino]methyl]furan-2-yl]-N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]quinazolin-4-amine |
| SMILES | C/C=C/CNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C30H26ClFN4O2/c1-2-3-13-33-17-24-9-12-28(38-24)21-7-10-27-25(15-21)30(35-19-34-27)36-23-8-11-29(26(31)16-23)37-18-20-5-4-6-22(32)14-20/h2-12,14-16,19,33H,13,17-18H2,1H3,(H,34,35,36)/b3-2+ |
| InChIKey | SKJGKYQPHMGIQV-NSCUHMNNSA-N |
| XLogP | 7.67 |
| TPSA | 72.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|