C30H28ClFN4O3 — CID 90196858
4-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]butan-1-ol (PubChem CID 90196858) has the molecular formula C30H28ClFN4O3 and a molecular weight of 547.03 g/mol. Its IUPAC name is 4-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]butan-1-ol.
| Compound Name | 4-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]butan-1-ol |
|---|---|
| PubChem CID | 90196858 |
| Molecular Formula | C30H28ClFN4O3 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 4-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]butan-1-ol |
| SMILES | OCCCCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C30H28ClFN4O3/c31-26-16-23(7-10-29(26)38-18-20-4-3-5-22(32)14-20)36-30-25-15-21(6-9-27(25)34-19-35-30)28-11-8-24(39-28)17-33-12-1-2-13-37/h3-11,14-16,19,33,37H,1-2,12-13,17-18H2,(H,34,35,36) |
| InChIKey | CGCGWSIFPURKFM-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|