C43H42ClFN4O9S2 — CID 90196896
3-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propan-1-ol;bis(4-methylbenzenesulfonic acid) (PubChem CID 90196896) has the molecular formula C43H42ClFN4O9S2 and a molecular weight of 877.41 g/mol. Its IUPAC name is 3-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propan-1-ol;bis(4-methylbenzenesulfonic acid).
| Compound Name | 3-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propan-1-ol;bis(4-methylbenzenesulfonic acid) |
|---|---|
| PubChem CID | 90196896 |
| Molecular Formula | C43H42ClFN4O9S2 |
| Molecular Weight | 877.41 g/mol |
| Exact Mass | 876.21 |
| IUPAC Name | 3-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propan-1-ol;bis(4-methylbenzenesulfonic acid) |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Cc1ccc(S(=O)(=O)O)cc1.OCCCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C29H26ClFN4O3.2C7H8O3S/c30-25-15-22(6-9-28(25)37-17-19-3-1-4-21(31)13-19)35-29-24-14-20(5-8-26(24)33-18-34-29)27-10-7-23(38-27)16-32-11-2-12-36;2*1-6-2-4-7(5-3-6)11(8,9)10/h1,3-10,13-15,18,32,36H,2,11-12,16-17H2,(H,33,34,35);2*2-5H,1H3,(H,8,9,10) |
| InChIKey | CZKSWKNMBZRFAG-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 201.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.41 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|