C28H23ClFN4O3S+ — CID 174069350
2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethyl-oxosulfanium (PubChem CID 174069350) has the molecular formula C28H23ClFN4O3S+ and a molecular weight of 550.04 g/mol. Its IUPAC name is 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethyl-oxosulfanium.
| Compound Name | 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethyl-oxosulfanium |
|---|---|
| PubChem CID | 174069350 |
| Molecular Formula | C28H23ClFN4O3S+ |
| Molecular Weight | 550.04 g/mol |
| Exact Mass | 549.12 |
| IUPAC Name | 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethyl-oxosulfanium |
| SMILES | O=[S+]CCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C28H23ClFN4O3S/c29-24-14-21(5-8-27(24)36-16-18-2-1-3-20(30)12-18)34-28-23-13-19(4-7-25(23)32-17-33-28)26-9-6-22(37-26)15-31-10-11-38-35/h1-9,12-14,17,31H,10-11,15-16H2,(H,32,33,34)/q+1 |
| InChIKey | ZICYTFQMKLMFPD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.04 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|