C30H27ClFN5O4S — CID 146741807
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[[2-[(methylideneamino)methylsulfonyl]ethylamino]methyl]furan-2-yl]quinazolin-4-amine (PubChem CID 146741807) has the molecular formula C30H27ClFN5O4S and a molecular weight of 608.10 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[[2-[(methylideneamino)methylsulfonyl]ethylamino]methyl]furan-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[[2-[(methylideneamino)methylsulfonyl]ethylamino]methyl]furan-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 146741807 |
| Molecular Formula | C30H27ClFN5O4S |
| Molecular Weight | 608.10 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[[2-[(methylideneamino)methylsulfonyl]ethylamino]methyl]furan-2-yl]quinazolin-4-amine |
| SMILES | C=NCS(=O)(=O)CCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C30H27ClFN5O4S/c1-33-19-42(38,39)12-11-34-16-24-7-10-28(41-24)21-5-8-27-25(14-21)30(36-18-35-27)37-23-6-9-29(26(31)15-23)40-17-20-3-2-4-22(32)13-20/h2-10,13-15,18,34H,1,11-12,16-17,19H2,(H,35,36,37) |
| InChIKey | RKYVMBDYNBUFLV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.10 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|