C33H32ClFN4O4 — CID 69008001
methyl 6-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]hexanoate (PubChem CID 69008001) has the molecular formula C33H32ClFN4O4 and a molecular weight of 603.09 g/mol. Its IUPAC name is methyl 6-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]hexanoate.
| Compound Name | methyl 6-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]hexanoate |
|---|---|
| PubChem CID | 69008001 |
| Molecular Formula | C33H32ClFN4O4 |
| Molecular Weight | 603.09 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | methyl 6-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]hexanoate |
| SMILES | COC(=O)CCCCCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C33H32ClFN4O4/c1-41-32(40)8-3-2-4-15-36-19-26-11-14-30(43-26)23-9-12-29-27(17-23)33(38-21-37-29)39-25-10-13-31(28(34)18-25)42-20-22-6-5-7-24(35)16-22/h5-7,9-14,16-18,21,36H,2-4,8,15,19-20H2,1H3,(H,37,38,39) |
| InChIKey | QWZWVXJTWNUIKR-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 98.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.09 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|