C28H25ClFN5O4S — CID 51348454
2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethanesulfonamide (PubChem CID 51348454) has the molecular formula C28H25ClFN5O4S and a molecular weight of 582.06 g/mol. Its IUPAC name is 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethanesulfonamide.
| Compound Name | 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 51348454 |
| Molecular Formula | C28H25ClFN5O4S |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C28H25ClFN5O4S/c29-24-14-21(5-8-27(24)38-16-18-2-1-3-20(30)12-18)35-28-23-13-19(4-7-25(23)33-17-34-28)26-9-6-22(39-26)15-32-10-11-40(31,36)37/h1-9,12-14,17,32H,10-11,15-16H2,(H2,31,36,37)(H,33,34,35) |
| InChIKey | ZZKJYWJMKZJTKA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|