C29H27ClFN5O4S — CID 51348752
2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]-N-methylethanesulfonamide (PubChem CID 51348752) has the molecular formula C29H27ClFN5O4S and a molecular weight of 596.08 g/mol. Its IUPAC name is 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 51348752 |
| Molecular Formula | C29H27ClFN5O4S |
| Molecular Weight | 596.08 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 2-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C29H27ClFN5O4S/c1-32-41(37,38)12-11-33-16-23-7-10-27(40-23)20-5-8-26-24(14-20)29(35-18-34-26)36-22-6-9-28(25(30)15-22)39-17-19-3-2-4-21(31)13-19/h2-10,13-15,18,32-33H,11-12,16-17H2,1H3,(H,34,35,36) |
| InChIKey | SUSUDACYYZSROJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.08 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|