C29H26ClFN4O4 — CID 90197005
1-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propane-1,3-diol (PubChem CID 90197005) has the molecular formula C29H26ClFN4O4 and a molecular weight of 549.00 g/mol. Its IUPAC name is 1-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propane-1,3-diol.
| Compound Name | 1-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 90197005 |
| Molecular Formula | C29H26ClFN4O4 |
| Molecular Weight | 549.00 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 1-[[5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]furan-2-yl]methylamino]propane-1,3-diol |
| SMILES | OCCC(O)NCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)o1 |
| InChI | InChI=1S/C29H26ClFN4O4/c30-24-14-21(5-8-27(24)38-16-18-2-1-3-20(31)12-18)35-29-23-13-19(4-7-25(23)33-17-34-29)26-9-6-22(39-26)15-32-28(37)10-11-36/h1-9,12-14,17,28,32,36-37H,10-11,15-16H2,(H,33,34,35) |
| InChIKey | ANNPMKLKDOPMHA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 112.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|