C45H33ClN8O4 — CID 157169301
6-chloro-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;5-[4-(4-phenylmethoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde (PubChem CID 157169301) has the molecular formula C45H33ClN8O4 and a molecular weight of 785.26 g/mol. Its IUPAC name is 6-chloro-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;5-[4-(4-phenylmethoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde.
| Compound Name | 6-chloro-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;5-[4-(4-phenylmethoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 157169301 |
| Molecular Formula | C45H33ClN8O4 |
| Molecular Weight | 785.26 g/mol |
| Exact Mass | 784.23 |
| IUPAC Name | 6-chloro-N-(4-phenylmethoxyphenyl)pyrido[3,4-d]pyrimidin-4-amine;5-[4-(4-phenylmethoxyanilino)pyrido[3,4-d]pyrimidin-6-yl]furan-2-carbaldehyde |
| SMILES | Clc1cc2c(Nc3ccc(OCc4ccccc4)cc3)ncnc2cn1.O=Cc1ccc(-c2cc3c(Nc4ccc(OCc5ccccc5)cc4)ncnc3cn2)o1 |
| InChI | InChI=1S/C25H18N4O3.C20H15ClN4O/c30-14-20-10-11-24(32-20)22-12-21-23(13-26-22)27-16-28-25(21)29-18-6-8-19(9-7-18)31-15-17-4-2-1-3-5-17;21-19-10-17-18(11-22-19)23-13-24-20(17)25-15-6-8-16(9-7-15)26-12-14-4-2-1-3-5-14/h1-14,16H,15H2,(H,27,28,29);1-11,13H,12H2,(H,23,24,25) |
| InChIKey | ANGQERMKLJURJG-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 150.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.26 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|