C27H21FN4O4 — CID 143805213
5-[4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]quinazolin-6-yl]-N-hydroxyfuran-2-carboxamide (PubChem CID 143805213) has the molecular formula C27H21FN4O4 and a molecular weight of 484.49 g/mol. Its IUPAC name is 5-[4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]quinazolin-6-yl]-N-hydroxyfuran-2-carboxamide.
| Compound Name | 5-[4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]quinazolin-6-yl]-N-hydroxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 143805213 |
| Molecular Formula | C27H21FN4O4 |
| Molecular Weight | 484.49 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 5-[4-[4-[(3-fluorophenyl)methoxy]-3-methylanilino]quinazolin-6-yl]-N-hydroxyfuran-2-carboxamide |
| SMILES | Cc1cc(Nc2ncnc3ccc(-c4ccc(C(=O)NO)o4)cc23)ccc1OCc1cccc(F)c1 |
| InChI | InChI=1S/C27H21FN4O4/c1-16-11-20(6-8-23(16)35-14-17-3-2-4-19(28)12-17)31-26-21-13-18(5-7-22(21)29-15-30-26)24-9-10-25(36-24)27(33)32-34/h2-13,15,34H,14H2,1H3,(H,32,33)(H,29,30,31) |
| InChIKey | AOGYYGXFQCVWNY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.49 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|