C29H29ClFN3O4 — CID 143645773
7-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxyheptanal (PubChem CID 143645773) has the molecular formula C29H29ClFN3O4 and a molecular weight of 538.02 g/mol. Its IUPAC name is 7-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxyheptanal.
| Compound Name | 7-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxyheptanal |
|---|---|
| PubChem CID | 143645773 |
| Molecular Formula | C29H29ClFN3O4 |
| Molecular Weight | 538.02 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 7-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxyheptanal |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1OCCCCCCC=O |
| InChI | InChI=1S/C29H29ClFN3O4/c1-36-27-17-25-23(16-28(27)37-13-6-4-2-3-5-12-35)29(33-19-32-25)34-22-10-11-26(24(30)15-22)38-18-20-8-7-9-21(31)14-20/h7-12,14-17,19H,2-6,13,18H2,1H3,(H,32,33,34) |
| InChIKey | COISYSBJNVIIFP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.02 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|