C28H30ClFN4O4S — CID 54027393
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine (PubChem CID 54027393) has the molecular formula C28H30ClFN4O4S and a molecular weight of 573.09 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 54027393 |
| Molecular Formula | C28H30ClFN4O4S |
| Molecular Weight | 573.09 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCCCCOc1ccc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2c1 |
| InChI | InChI=1S/C28H30ClFN4O4S/c1-39(35,36)14-12-31-11-2-3-13-37-23-8-9-24-26(17-23)32-19-33-28(24)34-22-7-10-27(25(29)16-22)38-18-20-5-4-6-21(30)15-20/h4-10,15-17,19,31H,2-3,11-14,18H2,1H3,(H,32,33,34) |
| InChIKey | LDDXZDJDPOPRGI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.09 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|