C29H30ClFN6O5S — CID 69463237
3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3-[[2-(2-methylsulfonylethylamino)acetyl]amino]propanamide (PubChem CID 69463237) has the molecular formula C29H30ClFN6O5S and a molecular weight of 629.11 g/mol. Its IUPAC name is 3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3-[[2-(2-methylsulfonylethylamino)acetyl]amino]propanamide.
| Compound Name | 3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3-[[2-(2-methylsulfonylethylamino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 69463237 |
| Molecular Formula | C29H30ClFN6O5S |
| Molecular Weight | 629.11 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | 3-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-3-[[2-(2-methylsulfonylethylamino)acetyl]amino]propanamide |
| SMILES | CS(=O)(=O)CCNCC(=O)NC(CC(N)=O)c1ccc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C29H30ClFN6O5S/c1-43(40,41)10-9-33-15-28(39)37-25(14-27(32)38)19-5-7-24-22(12-19)29(35-17-34-24)36-21-6-8-26(23(30)13-21)42-16-18-3-2-4-20(31)11-18/h2-8,11-13,17,25,33H,9-10,14-16H2,1H3,(H2,32,38)(H,37,39)(H,34,35,36) |
| InChIKey | BXMCEOYBNXXMCP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 165.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.11 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|