C29H27ClFN5O3S — CID 25176913
N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1H-pyrrol-2-yl]quinazolin-4-amine (PubChem CID 25176913) has the molecular formula C29H27ClFN5O3S and a molecular weight of 580.09 g/mol. Its IUPAC name is N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1H-pyrrol-2-yl]quinazolin-4-amine.
| Compound Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1H-pyrrol-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 25176913 |
| Molecular Formula | C29H27ClFN5O3S |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | N-[3-chloro-4-[(3-fluorophenyl)methoxy]phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1H-pyrrol-2-yl]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCc1ccc(-c2ccc3ncnc(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)c3c2)[nH]1 |
| InChI | InChI=1S/C29H27ClFN5O3S/c1-40(37,38)12-11-32-16-23-6-9-26(35-23)20-5-8-27-24(14-20)29(34-18-33-27)36-22-7-10-28(25(30)15-22)39-17-19-3-2-4-21(31)13-19/h2-10,13-15,18,32,35H,11-12,16-17H2,1H3,(H,33,34,36) |
| InChIKey | FSNJTTVADOTNBL-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|