C34H35ClFN5O7S — CID 24945604
5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-7-yl]oxy-N-hydroxypentanamide (PubChem CID 24945604) has the molecular formula C34H35ClFN5O7S and a molecular weight of 712.20 g/mol. Its IUPAC name is 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-7-yl]oxy-N-hydroxypentanamide.
| Compound Name | 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-7-yl]oxy-N-hydroxypentanamide |
|---|---|
| PubChem CID | 24945604 |
| Molecular Formula | C34H35ClFN5O7S |
| Molecular Weight | 712.20 g/mol |
| Exact Mass | 711.19 |
| IUPAC Name | 5-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]quinazolin-7-yl]oxy-N-hydroxypentanamide |
| SMILES | CS(=O)(=O)CCNCc1ccc(-c2cc3c(Nc4ccc(OCc5cccc(F)c5)c(Cl)c4)ncnc3cc2OCCCCC(=O)NO)o1 |
| InChI | InChI=1S/C34H35ClFN5O7S/c1-49(44,45)14-12-37-19-25-9-11-30(48-25)27-17-26-29(18-32(27)46-13-3-2-7-33(42)41-43)38-21-39-34(26)40-24-8-10-31(28(35)16-24)47-20-22-5-4-6-23(36)15-22/h4-6,8-11,15-18,21,37,43H,2-3,7,12-14,19-20H2,1H3,(H,41,42)(H,38,39,40) |
| InChIKey | UHABHXWIYULETL-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 164.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.20 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|