C27H27ClFN5O4 — CID 77269267
2-amino-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]propanamide (PubChem CID 77269267) has the molecular formula C27H27ClFN5O4 and a molecular weight of 540.00 g/mol. Its IUPAC name is 2-amino-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]propanamide.
| Compound Name | 2-amino-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]propanamide |
|---|---|
| PubChem CID | 77269267 |
| Molecular Formula | C27H27ClFN5O4 |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 2-amino-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-(2-methoxyethoxy)quinazolin-6-yl]propanamide |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NC(=O)C(C)N |
| InChI | InChI=1S/C27H27ClFN5O4/c1-16(30)27(35)34-23-12-20-22(13-25(23)37-9-8-36-2)31-15-32-26(20)33-19-6-7-24(21(28)11-19)38-14-17-4-3-5-18(29)10-17/h3-7,10-13,15-16H,8-9,14,30H2,1-2H3,(H,34,35)(H,31,32,33) |
| InChIKey | BYZBKAVGLRXARV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|