C30H30ClFN6O3 — CID 66634414
(6aR)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 66634414) has the molecular formula C30H30ClFN6O3 and a molecular weight of 577.06 g/mol. Its IUPAC name is (6aR)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (6aR)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 66634414 |
| Molecular Formula | C30H30ClFN6O3 |
| Molecular Weight | 577.06 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | (6aR)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | COc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NC(=O)N1CC2CCN(C)[C@H]2C1 |
| InChI | InChI=1S/C30H30ClFN6O3/c1-37-9-8-19-14-38(15-26(19)37)30(39)36-25-12-22-24(13-28(25)40-2)33-17-34-29(22)35-21-6-7-27(23(31)11-21)41-16-18-4-3-5-20(32)10-18/h3-7,10-13,17,19,26H,8-9,14-16H2,1-2H3,(H,36,39)(H,33,34,35)/t19?,26-/m0/s1 |
| InChIKey | SZICWFNKMRTTJQ-SYCQMTRVSA-N |
| XLogP | 5.92 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.06 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |