C29H28ClFN6O2 — CID 66631558
(3aS,6aS)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide (PubChem CID 66631558) has the molecular formula C29H28ClFN6O2 and a molecular weight of 547.03 g/mol. Its IUPAC name is (3aS,6aS)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide.
| Compound Name | (3aS,6aS)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 66631558 |
| Molecular Formula | C29H28ClFN6O2 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | (3aS,6aS)-N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]-1-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxamide |
| SMILES | CN1CC[C@H]2CN(C(=O)Nc3ccc4ncnc(Nc5ccc(OCc6cccc(F)c6)c(Cl)c5)c4c3)C[C@H]21 |
| InChI | InChI=1S/C29H28ClFN6O2/c1-36-10-9-19-14-37(15-26(19)36)29(38)35-21-5-7-25-23(12-21)28(33-17-32-25)34-22-6-8-27(24(30)13-22)39-16-18-3-2-4-20(31)11-18/h2-8,11-13,17,19,26H,9-10,14-16H2,1H3,(H,35,38)(H,32,33,34)/t19-,26+/m0/s1 |
| InChIKey | LNAGWIQHNHHUTE-AFMDSPMNSA-N |
| XLogP | 5.91 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |