C31H32ClFN4O3S2 — CID 135236786
N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-2-(dithiolan-4-yl)pentanamide (PubChem CID 135236786) has the molecular formula C31H32ClFN4O3S2 and a molecular weight of 627.21 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-2-(dithiolan-4-yl)pentanamide.
| Compound Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-2-(dithiolan-4-yl)pentanamide |
|---|---|
| PubChem CID | 135236786 |
| Molecular Formula | C31H32ClFN4O3S2 |
| Molecular Weight | 627.21 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-2-(dithiolan-4-yl)pentanamide |
| SMILES | CCCC(C(=O)Nc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2cc1OCC)C1CSSC1 |
| InChI | InChI=1S/C31H32ClFN4O3S2/c1-3-6-23(20-16-41-42-17-20)31(38)37-27-13-24-26(14-29(27)39-4-2)34-18-35-30(24)36-22-9-10-28(25(32)12-22)40-15-19-7-5-8-21(33)11-19/h5,7-14,18,20,23H,3-4,6,15-17H2,1-2H3,(H,37,38)(H,34,35,36) |
| InChIKey | NMDCHZUJYVEXDV-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.21 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|