C30H32ClFN4O4S3 — CID 135236859
N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide (PubChem CID 135236859) has the molecular formula C30H32ClFN4O4S3 and a molecular weight of 663.26 g/mol. Its IUPAC name is N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide.
| Compound Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 135236859 |
| Molecular Formula | C30H32ClFN4O4S3 |
| Molecular Weight | 663.26 g/mol |
| Exact Mass | 662.13 |
| IUPAC Name | N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1NS(=O)(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C30H32ClFN4O4S3/c1-2-39-29-17-26-24(16-27(29)36-43(37,38)13-4-3-8-23-11-12-41-42-23)30(34-19-33-26)35-22-9-10-28(25(31)15-22)40-18-20-6-5-7-21(32)14-20/h5-7,9-10,14-17,19,23,36H,2-4,8,11-13,18H2,1H3,(H,33,34,35) |
| InChIKey | LFXGMMNEGYRSMU-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.26 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|