C23H26ClFN4O3S3 — CID 135236542
N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide (PubChem CID 135236542) has the molecular formula C23H26ClFN4O3S3 and a molecular weight of 557.14 g/mol. Its IUPAC name is N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide.
| Compound Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 135236542 |
| Molecular Formula | C23H26ClFN4O3S3 |
| Molecular Weight | 557.14 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | N-[4-(3-chloro-4-fluoroanilino)-7-ethoxyquinazolin-6-yl]-4-(dithiolan-3-yl)butane-1-sulfonamide |
| SMILES | CCOc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NS(=O)(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C23H26ClFN4O3S3/c1-2-32-22-13-20-17(23(27-14-26-20)28-15-6-7-19(25)18(24)11-15)12-21(22)29-35(30,31)10-4-3-5-16-8-9-33-34-16/h6-7,11-14,16,29H,2-5,8-10H2,1H3,(H,26,27,28) |
| InChIKey | ZOMQMYGMZOIIFY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.14 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|