C29H32ClFN4O6 — CID 143120823
6-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxy-1-(methylamino)hexane-1,3,5-triol (PubChem CID 143120823) has the molecular formula C29H32ClFN4O6 and a molecular weight of 587.05 g/mol. Its IUPAC name is 6-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxy-1-(methylamino)hexane-1,3,5-triol.
| Compound Name | 6-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxy-1-(methylamino)hexane-1,3,5-triol |
|---|---|
| PubChem CID | 143120823 |
| Molecular Formula | C29H32ClFN4O6 |
| Molecular Weight | 587.05 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | 6-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-methoxyquinazolin-6-yl]oxy-1-(methylamino)hexane-1,3,5-triol |
| SMILES | CNC(O)CC(O)CC(O)COc1cc2c(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)ncnc2cc1OC |
| InChI | InChI=1S/C29H32ClFN4O6/c1-32-28(38)11-20(36)10-21(37)15-41-27-12-22-24(13-26(27)39-2)33-16-34-29(22)35-19-6-7-25(23(30)9-19)40-14-17-4-3-5-18(31)8-17/h3-9,12-13,16,20-21,28,32,36-38H,10-11,14-15H2,1-2H3,(H,33,34,35) |
| InChIKey | LJQVZRILMNZARW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.05 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|