C25H27N5O4S2 — CID 67565911
N-[4-(benzenesulfonyl)phenyl]-6-[3-(2-methylsulfonylethylamino)propyl]pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 67565911) has the molecular formula C25H27N5O4S2 and a molecular weight of 525.66 g/mol. Its IUPAC name is N-[4-(benzenesulfonyl)phenyl]-6-[3-(2-methylsulfonylethylamino)propyl]pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[4-(benzenesulfonyl)phenyl]-6-[3-(2-methylsulfonylethylamino)propyl]pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67565911 |
| Molecular Formula | C25H27N5O4S2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | N-[4-(benzenesulfonyl)phenyl]-6-[3-(2-methylsulfonylethylamino)propyl]pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CS(=O)(=O)CCNCCCc1cc2c(Nc3ccc(S(=O)(=O)c4ccccc4)cc3)ncnc2cn1 |
| InChI | InChI=1S/C25H27N5O4S2/c1-35(31,32)15-14-26-13-5-6-20-16-23-24(17-27-20)28-18-29-25(23)30-19-9-11-22(12-10-19)36(33,34)21-7-3-2-4-8-21/h2-4,7-12,16-18,26H,5-6,13-15H2,1H3,(H,28,29,30) |
| InChIKey | FRKIYHCUCWSELJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|