C27H29N5O4S2 — CID 67564968
4-N-[4-(benzenesulfonyl)phenyl]-6-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine (PubChem CID 67564968) has the molecular formula C27H29N5O4S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is 4-N-[4-(benzenesulfonyl)phenyl]-6-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[4-(benzenesulfonyl)phenyl]-6-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 67564968 |
| Molecular Formula | C27H29N5O4S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 4-N-[4-(benzenesulfonyl)phenyl]-6-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine |
| SMILES | O=S1(=O)CCN(CCCNc2ccc3ncnc(Nc4ccc(S(=O)(=O)c5ccccc5)cc4)c3c2)CC1 |
| InChI | InChI=1S/C27H29N5O4S2/c33-37(34)17-15-32(16-18-37)14-4-13-28-22-9-12-26-25(19-22)27(30-20-29-26)31-21-7-10-24(11-8-21)38(35,36)23-5-2-1-3-6-23/h1-3,5-12,19-20,28H,4,13-18H2,(H,29,30,31) |
| InChIKey | OPDGDCCLNPZRNY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|