C29H31N7OS — CID 67609255
4-N-(1-benzylindazol-5-yl)-6-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine (PubChem CID 67609255) has the molecular formula C29H31N7OS and a molecular weight of 525.68 g/mol. Its IUPAC name is 4-N-(1-benzylindazol-5-yl)-6-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-(1-benzylindazol-5-yl)-6-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 67609255 |
| Molecular Formula | C29H31N7OS |
| Molecular Weight | 525.68 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 4-N-(1-benzylindazol-5-yl)-6-N-[3-(1-oxo-1,4-thiazinan-4-yl)propyl]quinazoline-4,6-diamine |
| SMILES | O=S1CCN(CCCNc2ccc3ncnc(Nc4ccc5c(cnn5Cc5ccccc5)c4)c3c2)CC1 |
| InChI | InChI=1S/C29H31N7OS/c37-38-15-13-35(14-16-38)12-4-11-30-24-7-9-27-26(18-24)29(32-21-31-27)34-25-8-10-28-23(17-25)19-33-36(28)20-22-5-2-1-3-6-22/h1-3,5-10,17-19,21,30H,4,11-16,20H2,(H,31,32,34) |
| InChIKey | ICEYNFMNQBNIOK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|