C27H28N6O3S — CID 67564900
N-(1-benzylindazol-5-yl)-6-[2-(2-methylsulfonylethylamino)ethoxy]quinazolin-4-amine (PubChem CID 67564900) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is N-(1-benzylindazol-5-yl)-6-[2-(2-methylsulfonylethylamino)ethoxy]quinazolin-4-amine.
| Compound Name | N-(1-benzylindazol-5-yl)-6-[2-(2-methylsulfonylethylamino)ethoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 67564900 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | N-(1-benzylindazol-5-yl)-6-[2-(2-methylsulfonylethylamino)ethoxy]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCCOc1ccc2ncnc(Nc3ccc4c(cnn4Cc4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C27H28N6O3S/c1-37(34,35)14-12-28-11-13-36-23-8-9-25-24(16-23)27(30-19-29-25)32-22-7-10-26-21(15-22)17-31-33(26)18-20-5-3-2-4-6-20/h2-10,15-17,19,28H,11-14,18H2,1H3,(H,29,30,32) |
| InChIKey | QYSRLBFRZMSXFH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|