C30H34N6O4S — CID 56976292
2-(1-benzylindazol-5-yl)-6-methoxy-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine (PubChem CID 56976292) has the molecular formula C30H34N6O4S and a molecular weight of 574.71 g/mol. Its IUPAC name is 2-(1-benzylindazol-5-yl)-6-methoxy-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine.
| Compound Name | 2-(1-benzylindazol-5-yl)-6-methoxy-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 56976292 |
| Molecular Formula | C30H34N6O4S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 2-(1-benzylindazol-5-yl)-6-methoxy-7-[4-(2-methylsulfonylethylamino)butoxy]quinazolin-4-amine |
| SMILES | COc1cc2c(N)nc(-c3ccc4c(cnn4Cc4ccccc4)c3)nc2cc1OCCCCNCCS(C)(=O)=O |
| InChI | InChI=1S/C30H34N6O4S/c1-39-27-17-24-25(18-28(27)40-14-7-6-12-32-13-15-41(2,37)38)34-30(35-29(24)31)22-10-11-26-23(16-22)19-33-36(26)20-21-8-4-3-5-9-21/h3-5,8-11,16-19,32H,6-7,12-15,20H2,1-2H3,(H2,31,34,35) |
| InChIKey | HAQIBWYICXOLNK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 134.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|