C29H33FN6O3S — CID 67565480
4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-6-methoxy-7-[3-(2-methylsulfonylethylamino)propyl]-1H-quinazolin-4-amine (PubChem CID 67565480) has the molecular formula C29H33FN6O3S and a molecular weight of 564.69 g/mol. Its IUPAC name is 4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-6-methoxy-7-[3-(2-methylsulfonylethylamino)propyl]-1H-quinazolin-4-amine.
| Compound Name | 4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-6-methoxy-7-[3-(2-methylsulfonylethylamino)propyl]-1H-quinazolin-4-amine |
|---|---|
| PubChem CID | 67565480 |
| Molecular Formula | C29H33FN6O3S |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-6-methoxy-7-[3-(2-methylsulfonylethylamino)propyl]-1H-quinazolin-4-amine |
| SMILES | COc1cc2c(cc1CCCNCCS(C)(=O)=O)NC=NC2(N)c1ccc2c(cnn2Cc2cccc(F)c2)c1 |
| InChI | InChI=1S/C29H33FN6O3S/c1-39-28-16-25-26(15-21(28)6-4-10-32-11-12-40(2,37)38)33-19-34-29(25,31)23-8-9-27-22(14-23)17-35-36(27)18-20-5-3-7-24(30)13-20/h3,5,7-9,13-17,19,32H,4,6,10-12,18,31H2,1-2H3,(H,33,34) |
| InChIKey | DESVEPTVRXFIAH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|