C22H18FN5O — CID 67563822
4-amino-4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-1H-quinazolin-6-ol (PubChem CID 67563822) has the molecular formula C22H18FN5O and a molecular weight of 387.42 g/mol. Its IUPAC name is 4-amino-4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-1H-quinazolin-6-ol.
| Compound Name | 4-amino-4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-1H-quinazolin-6-ol |
|---|---|
| PubChem CID | 67563822 |
| Molecular Formula | C22H18FN5O |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-amino-4-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-1H-quinazolin-6-ol |
| SMILES | NC1(c2ccc3c(cnn3Cc3cccc(F)c3)c2)N=CNc2ccc(O)cc21 |
| InChI | InChI=1S/C22H18FN5O/c23-17-3-1-2-14(8-17)12-28-21-7-4-16(9-15(21)11-27-28)22(24)19-10-18(29)5-6-20(19)25-13-26-22/h1-11,13,29H,12,24H2,(H,25,26) |
| InChIKey | QTQWOLUAGGWSRL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|