C26H23FN8O — CID 66920497
4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-4,6-diamine (PubChem CID 66920497) has the molecular formula C26H23FN8O and a molecular weight of 482.52 g/mol. Its IUPAC name is 4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-4,6-diamine.
| Compound Name | 4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 66920497 |
| Molecular Formula | C26H23FN8O |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 4-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]-5-[[(4-methoxyphenyl)hydrazinylidene]methyl]pyrimidine-4,6-diamine |
| SMILES | COc1ccc(NN=Cc2c(N)ncnc2Nc2ccc3c(cnn3Cc3cccc(F)c3)c2)cc1 |
| InChI | InChI=1S/C26H23FN8O/c1-36-22-8-5-20(6-9-22)34-31-14-23-25(28)29-16-30-26(23)33-21-7-10-24-18(12-21)13-32-35(24)15-17-3-2-4-19(27)11-17/h2-14,16,34H,15H2,1H3,(H3,28,29,30,33) |
| InChIKey | VILZLAGIVFSSSZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|