C22H18FN5O2 — CID 141400540
(E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoic acid (PubChem CID 141400540) has the molecular formula C22H18FN5O2 and a molecular weight of 403.42 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141400540 |
| Molecular Formula | C22H18FN5O2 |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (E)-3-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-6-methylpyrimidin-5-yl]prop-2-enoic acid |
| SMILES | Cc1ncnc(Nc2ccc3c(cnn3Cc3cccc(F)c3)c2)c1/C=C/C(=O)O |
| InChI | InChI=1S/C22H18FN5O2/c1-14-19(6-8-21(29)30)22(25-13-24-14)27-18-5-7-20-16(10-18)11-26-28(20)12-15-3-2-4-17(23)9-15/h2-11,13H,12H2,1H3,(H,29,30)(H,24,25,27)/b8-6+ |
| InChIKey | JWGGVQRGSGNOSZ-SOFGYWHQSA-N |
| XLogP | 4.16 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|