C23H16FN7O2S — CID 141400546
4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-(5-formyl-1,3-thiazol-2-yl)pyrimidine-5-carboxamide (PubChem CID 141400546) has the molecular formula C23H16FN7O2S and a molecular weight of 473.49 g/mol. Its IUPAC name is 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-(5-formyl-1,3-thiazol-2-yl)pyrimidine-5-carboxamide.
| Compound Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-(5-formyl-1,3-thiazol-2-yl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 141400546 |
| Molecular Formula | C23H16FN7O2S |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-(5-formyl-1,3-thiazol-2-yl)pyrimidine-5-carboxamide |
| SMILES | O=Cc1cnc(NC(=O)c2cncnc2Nc2ccc3c(cnn3Cc3cccc(F)c3)c2)s1 |
| InChI | InChI=1S/C23H16FN7O2S/c24-16-3-1-2-14(6-16)11-31-20-5-4-17(7-15(20)8-28-31)29-21-19(10-25-13-27-21)22(33)30-23-26-9-18(12-32)34-23/h1-10,12-13H,11H2,(H,25,27,29)(H,26,30,33) |
| InChIKey | IEFJUDYEUSGBGQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|