C28H28FN7O3S — CID 141400553
4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 141400553) has the molecular formula C28H28FN7O3S and a molecular weight of 561.64 g/mol. Its IUPAC name is 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 141400553 |
| Molecular Formula | C28H28FN7O3S |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-N-[7-(hydroxyamino)-7-oxoheptyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | O=C(CCCCCCNC(=O)c1cc2c(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)ncnc2s1)NO |
| InChI | InChI=1S/C28H28FN7O3S/c29-20-7-5-6-18(12-20)16-36-23-10-9-21(13-19(23)15-33-36)34-26-22-14-24(40-28(22)32-17-31-26)27(38)30-11-4-2-1-3-8-25(37)35-39/h5-7,9-10,12-15,17,39H,1-4,8,11,16H2,(H,30,38)(H,35,37)(H,31,32,34) |
| InChIKey | GPVULBBYRKLNLF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 134.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|