C28H31FN6O2S — CID 141400520
7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methyl-2H-thieno[2,3-d]pyrimidin-1-yl]-N-hydroxyheptanamide (PubChem CID 141400520) has the molecular formula C28H31FN6O2S and a molecular weight of 534.66 g/mol. Its IUPAC name is 7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methyl-2H-thieno[2,3-d]pyrimidin-1-yl]-N-hydroxyheptanamide.
| Compound Name | 7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methyl-2H-thieno[2,3-d]pyrimidin-1-yl]-N-hydroxyheptanamide |
|---|---|
| PubChem CID | 141400520 |
| Molecular Formula | C28H31FN6O2S |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | 7-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-5-methyl-2H-thieno[2,3-d]pyrimidin-1-yl]-N-hydroxyheptanamide |
| SMILES | Cc1csc2c1C(Nc1ccc3c(cnn3Cc3cccc(F)c3)c1)=NCN2CCCCCCC(=O)NO |
| InChI | InChI=1S/C28H31FN6O2S/c1-19-17-38-28-26(19)27(30-18-34(28)12-5-3-2-4-9-25(36)33-37)32-23-10-11-24-21(14-23)15-31-35(24)16-20-7-6-8-22(29)13-20/h6-8,10-11,13-15,17,37H,2-5,9,12,16,18H2,1H3,(H,30,32)(H,33,36) |
| InChIKey | HDJZGTXIRZVAEQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 94.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|