C29H28FN5O4 — CID 141400565
ethyl 4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxybutanoate (PubChem CID 141400565) has the molecular formula C29H28FN5O4 and a molecular weight of 529.57 g/mol. Its IUPAC name is ethyl 4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxybutanoate.
| Compound Name | ethyl 4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxybutanoate |
|---|---|
| PubChem CID | 141400565 |
| Molecular Formula | C29H28FN5O4 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | ethyl 4-[4-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-7-methoxyquinazolin-6-yl]oxybutanoate |
| SMILES | CCOC(=O)CCCOc1cc2c(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)ncnc2cc1OC |
| InChI | InChI=1S/C29H28FN5O4/c1-3-38-28(36)8-5-11-39-27-14-23-24(15-26(27)37-2)31-18-32-29(23)34-22-9-10-25-20(13-22)16-33-35(25)17-19-6-4-7-21(30)12-19/h4,6-7,9-10,12-16,18H,3,5,8,11,17H2,1-2H3,(H,31,32,34) |
| InChIKey | UMFJCJXPTKMQAM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|