C29H28N8O2S — CID 71493130
N-(1-benzylindol-5-yl)-6-[4-[(2-methylsulfonylethylamino)methyl]triazol-1-yl]quinazolin-4-amine (PubChem CID 71493130) has the molecular formula C29H28N8O2S and a molecular weight of 552.66 g/mol. Its IUPAC name is N-(1-benzylindol-5-yl)-6-[4-[(2-methylsulfonylethylamino)methyl]triazol-1-yl]quinazolin-4-amine.
| Compound Name | N-(1-benzylindol-5-yl)-6-[4-[(2-methylsulfonylethylamino)methyl]triazol-1-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 71493130 |
| Molecular Formula | C29H28N8O2S |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | N-(1-benzylindol-5-yl)-6-[4-[(2-methylsulfonylethylamino)methyl]triazol-1-yl]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCc1cn(-c2ccc3ncnc(Nc4ccc5c(ccn5Cc5ccccc5)c4)c3c2)nn1 |
| InChI | InChI=1S/C29H28N8O2S/c1-40(38,39)14-12-30-17-24-19-37(35-34-24)25-8-9-27-26(16-25)29(32-20-31-27)33-23-7-10-28-22(15-23)11-13-36(28)18-21-5-3-2-4-6-21/h2-11,13,15-16,19-20,30H,12,14,17-18H2,1H3,(H,31,32,33) |
| InChIKey | LCXSNLXNBOLCDF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|