C27H25N5O4S3 — CID 67276824
N-[4-(benzenesulfonyl)phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-yl]quinazolin-4-amine (PubChem CID 67276824) has the molecular formula C27H25N5O4S3 and a molecular weight of 579.73 g/mol. Its IUPAC name is N-[4-(benzenesulfonyl)phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-yl]quinazolin-4-amine.
| Compound Name | N-[4-(benzenesulfonyl)phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 67276824 |
| Molecular Formula | C27H25N5O4S3 |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.11 |
| IUPAC Name | N-[4-(benzenesulfonyl)phenyl]-6-[5-[(2-methylsulfonylethylamino)methyl]-1,3-thiazol-2-yl]quinazolin-4-amine |
| SMILES | CS(=O)(=O)CCNCc1cnc(-c2ccc3ncnc(Nc4ccc(S(=O)(=O)c5ccccc5)cc4)c3c2)s1 |
| InChI | InChI=1S/C27H25N5O4S3/c1-38(33,34)14-13-28-16-21-17-29-27(37-21)19-7-12-25-24(15-19)26(31-18-30-25)32-20-8-10-23(11-9-20)39(35,36)22-5-3-2-4-6-22/h2-12,15,17-18,28H,13-14,16H2,1H3,(H,30,31,32) |
| InChIKey | LQERKCLPRJEODB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|